C19H20ClNO7S — CID 23072754
2-[4-chloro-2-[(4-nitrophenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 23072754) has the molecular formula C19H20ClNO7S and a molecular weight of 441.89 g/mol. Its IUPAC name is 2-[4-chloro-2-[(4-nitrophenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | 2-[4-chloro-2-[(4-nitrophenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 23072754 |
| Molecular Formula | C19H20ClNO7S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-[4-chloro-2-[(4-nitrophenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(Cc2cc(Cl)ccc2OC2SC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C19H20ClNO7S/c20-12-3-6-14(28-19-18(25)17(24)16(23)15(9-22)29-19)11(8-12)7-10-1-4-13(5-2-10)21(26)27/h1-6,8,15-19,22-25H,7,9H2 |
| InChIKey | ZJXDZFHUTNZWCR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|