C19H19ClF2O5S — CID 69201871
(2S,3R,4S,5S,6S)-2-[4-chloro-2-[(2,4-difluorophenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 69201871) has the molecular formula C19H19ClF2O5S and a molecular weight of 432.87 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-[4-chloro-2-[(2,4-difluorophenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6S)-2-[4-chloro-2-[(2,4-difluorophenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 69201871 |
| Molecular Formula | C19H19ClF2O5S |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-[4-chloro-2-[(2,4-difluorophenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | OC[C@@H]1S[C@H](Oc2ccc(Cl)cc2Cc2ccc(F)cc2F)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H19ClF2O5S/c20-11-2-4-14(10(6-11)5-9-1-3-12(21)7-13(9)22)27-19-18(26)17(25)16(24)15(8-23)28-19/h1-4,6-7,15-19,23-26H,5,8H2/t15-,16+,17-,18+,19-/m0/s1 |
| InChIKey | KKYRYQGLBHBOAX-APAFKAMOSA-N |
| XLogP | 2.10 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |