C14H23NO3S — CID 59771461
3-[[2-methyl-1-(3-methylphenyl)propan-2-yl]amino]propane-1-sulfonic acid (PubChem CID 59771461) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is 3-[[2-methyl-1-(3-methylphenyl)propan-2-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[2-methyl-1-(3-methylphenyl)propan-2-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59771461 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 3-[[2-methyl-1-(3-methylphenyl)propan-2-yl]amino]propane-1-sulfonic acid |
| SMILES | Cc1cccc(CC(C)(C)NCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H23NO3S/c1-12-6-4-7-13(10-12)11-14(2,3)15-8-5-9-19(16,17)18/h4,6-7,10,15H,5,8-9,11H2,1-3H3,(H,16,17,18) |
| InChIKey | PSNNNXPXWWMEPQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|