C5H7NNa2O6S — CID 59771661
disodium;4-sulfonatooxypyrrolidine-2-carboxylate (PubChem CID 59771661) has the molecular formula C5H7NNa2O6S and a molecular weight of 255.16 g/mol. Its IUPAC name is disodium;4-sulfonatooxypyrrolidine-2-carboxylate.
| Compound Name | disodium;4-sulfonatooxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59771661 |
| Molecular Formula | C5H7NNa2O6S |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | disodium;4-sulfonatooxypyrrolidine-2-carboxylate |
| SMILES | O=C([O-])C1CC(OS(=O)(=O)[O-])CN1.[Na+].[Na+] |
| InChI | InChI=1S/C5H9NO6S.2Na/c7-5(8)4-1-3(2-6-4)12-13(9,10)11;;/h3-4,6H,1-2H2,(H,7,8)(H,9,10,11);;/q;2*+1/p-2 |
| InChIKey | WQQVJZYIYNYGIF-UHFFFAOYSA-L |
| XLogP | -9.05 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | -9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|