C24H31NP+ — CID 59782045
(3-isoquinolin-3-ylphenyl)-tripropylphosphanium (PubChem CID 59782045) has the molecular formula C24H31NP+ and a molecular weight of 364.49 g/mol. Its IUPAC name is (3-isoquinolin-3-ylphenyl)-tripropylphosphanium.
| Compound Name | (3-isoquinolin-3-ylphenyl)-tripropylphosphanium |
|---|---|
| PubChem CID | 59782045 |
| Molecular Formula | C24H31NP+ |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (3-isoquinolin-3-ylphenyl)-tripropylphosphanium |
| SMILES | CCC[P+](CCC)(CCC)c1cccc(-c2cc3ccccc3cn2)c1 |
| InChI | InChI=1S/C24H31NP/c1-4-14-26(15-5-2,16-6-3)23-13-9-12-21(17-23)24-18-20-10-7-8-11-22(20)19-25-24/h7-13,17-19H,4-6,14-16H2,1-3H3/q+1 |
| InChIKey | QZEQEXXLEPUZPC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|