C19H17F4N3O2 — CID 59783653
2-fluoro-N-hydroxy-4-[(1R,4R)-5-[3-(trifluoromethyl)phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide (PubChem CID 59783653) has the molecular formula C19H17F4N3O2 and a molecular weight of 395.36 g/mol. Its IUPAC name is 2-fluoro-N-hydroxy-4-[(1R,4R)-5-[3-(trifluoromethyl)phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-hydroxy-4-[(1R,4R)-5-[3-(trifluoromethyl)phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide |
|---|---|
| PubChem CID | 59783653 |
| Molecular Formula | C19H17F4N3O2 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-fluoro-N-hydroxy-4-[(1R,4R)-5-[3-(trifluoromethyl)phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide |
| SMILES | O=C(NO)c1ccc(N2C[C@H]3C[C@@H]2CN3c2cccc(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C19H17F4N3O2/c20-17-8-13(4-5-16(17)18(27)24-28)26-10-14-7-15(26)9-25(14)12-3-1-2-11(6-12)19(21,22)23/h1-6,8,14-15,28H,7,9-10H2,(H,24,27)/t14-,15-/m1/s1 |
| InChIKey | AZYKLRVCQUMLRQ-HUUCEWRRSA-N |
| XLogP | 3.43 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|