C13H14NO2PW — CID 59786227
5-[(2-methylphenyl)methyl]-1,2-dihydropyrrol-2-ide;phosphanyloxymethanone;tungsten(2+) (PubChem CID 59786227) has the molecular formula C13H14NO2PW and a molecular weight of 431.07 g/mol. Its IUPAC name is 5-[(2-methylphenyl)methyl]-1,2-dihydropyrrol-2-ide;phosphanyloxymethanone;tungsten(2+).
| Compound Name | 5-[(2-methylphenyl)methyl]-1,2-dihydropyrrol-2-ide;phosphanyloxymethanone;tungsten(2+) |
|---|---|
| PubChem CID | 59786227 |
| Molecular Formula | C13H14NO2PW |
| Molecular Weight | 431.07 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 5-[(2-methylphenyl)methyl]-1,2-dihydropyrrol-2-ide;phosphanyloxymethanone;tungsten(2+) |
| SMILES | Cc1ccccc1Cc1cc[c-][nH]1.O=[C-]OP.[W+2] |
| InChI | InChI=1S/C12H12N.CH2O2P.W/c1-10-5-2-3-6-11(10)9-12-7-4-8-13-12;2-1-3-4;/h2-7,13H,9H2,1H3;4H2;/q2*-1;+2 |
| InChIKey | GHWYLLUAWPAZFU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.07 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|