C16H12N2O4S — CID 59788779
N-[2-(1,3-oxazole-4-carbonyl)phenyl]benzenesulfonamide (PubChem CID 59788779) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is N-[2-(1,3-oxazole-4-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-(1,3-oxazole-4-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59788779 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-[2-(1,3-oxazole-4-carbonyl)phenyl]benzenesulfonamide |
| SMILES | O=C(c1cocn1)c1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H12N2O4S/c19-16(15-10-22-11-17-15)13-8-4-5-9-14(13)18-23(20,21)12-6-2-1-3-7-12/h1-11,18H |
| InChIKey | LOYUZKUNVIIYHT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|