C21H22N2O9S2 — CID 59791221
3-[[2-cyano-3-[4-methoxy-2-(4-sulfobutoxy)phenyl]prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 59791221) has the molecular formula C21H22N2O9S2 and a molecular weight of 510.55 g/mol. Its IUPAC name is 3-[[2-cyano-3-[4-methoxy-2-(4-sulfobutoxy)phenyl]prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[2-cyano-3-[4-methoxy-2-(4-sulfobutoxy)phenyl]prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 59791221 |
| Molecular Formula | C21H22N2O9S2 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 3-[[2-cyano-3-[4-methoxy-2-(4-sulfobutoxy)phenyl]prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | COc1ccc(C=C(C#N)C(=O)Nc2cccc(S(=O)(=O)O)c2)c(OCCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C21H22N2O9S2/c1-31-18-8-7-15(20(13-18)32-9-2-3-10-33(25,26)27)11-16(14-22)21(24)23-17-5-4-6-19(12-17)34(28,29)30/h4-8,11-13H,2-3,9-10H2,1H3,(H,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | BDEJCGQQSPRADJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 180.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|