C14H7ClN6Na2O7S2 — CID 59794737
disodium;2-[[4-chloro-6-(cyanoamino)-1,3,5-triazin-2-yl]amino]-5-hydroxy-7-oxidoperoxysulfanylnaphthalene-1-sulfonate (PubChem CID 59794737) has the molecular formula C14H7ClN6Na2O7S2 and a molecular weight of 516.81 g/mol. Its IUPAC name is disodium;2-[[4-chloro-6-(cyanoamino)-1,3,5-triazin-2-yl]amino]-5-hydroxy-7-oxidoperoxysulfanylnaphthalene-1-sulfonate.
| Compound Name | disodium;2-[[4-chloro-6-(cyanoamino)-1,3,5-triazin-2-yl]amino]-5-hydroxy-7-oxidoperoxysulfanylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 59794737 |
| Molecular Formula | C14H7ClN6Na2O7S2 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 515.93 |
| IUPAC Name | disodium;2-[[4-chloro-6-(cyanoamino)-1,3,5-triazin-2-yl]amino]-5-hydroxy-7-oxidoperoxysulfanylnaphthalene-1-sulfonate |
| SMILES | N#CNc1nc(Cl)nc(Nc2ccc3c(O)cc(SOO[O-])cc3c2S(=O)(=O)[O-])n1.[Na+].[Na+] |
| InChI | InChI=1S/C14H9ClN6O7S2.2Na/c15-12-19-13(17-5-16)21-14(20-12)18-9-2-1-7-8(11(9)30(24,25)26)3-6(4-10(7)22)29-28-27-23;;/h1-4,22-23H,(H,24,25,26)(H2,17,18,19,20,21);;/q;2*+1/p-2 |
| InChIKey | PXHATYFUKNJXQR-UHFFFAOYSA-L |
| XLogP | -4.84 |
| TPSA | 205.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|