C10H10F4 — CID 59795341
2,3-bis(difluoromethyl)-1,4-dimethylbenzene (PubChem CID 59795341) has the molecular formula C10H10F4 and a molecular weight of 206.18 g/mol. Its IUPAC name is 2,3-bis(difluoromethyl)-1,4-dimethylbenzene.
| Compound Name | 2,3-bis(difluoromethyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 59795341 |
| Molecular Formula | C10H10F4 |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2,3-bis(difluoromethyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C(F)F)c1C(F)F |
| InChI | InChI=1S/C10H10F4/c1-5-3-4-6(2)8(10(13)14)7(5)9(11)12/h3-4,9-10H,1-2H3 |
| InChIKey | MYXRPFYIPSKKSZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |