C38H37IrNO3 — CID 59798558
[(Z)-1-(4-butan-2-ylphenoxy)-3-hydroxybut-2-enylidene]oxidanium;2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)quinoline;iridium (PubChem CID 59798558) has the molecular formula C38H37IrNO3 and a molecular weight of 747.94 g/mol. Its IUPAC name is [(Z)-1-(4-butan-2-ylphenoxy)-3-hydroxybut-2-enylidene]oxidanium;2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)quinoline;iridium.
| Compound Name | [(Z)-1-(4-butan-2-ylphenoxy)-3-hydroxybut-2-enylidene]oxidanium;2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)quinoline;iridium |
|---|---|
| PubChem CID | 59798558 |
| Molecular Formula | C38H37IrNO3 |
| Molecular Weight | 747.94 g/mol |
| Exact Mass | 748.24 |
| IUPAC Name | [(Z)-1-(4-butan-2-ylphenoxy)-3-hydroxybut-2-enylidene]oxidanium;2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)quinoline;iridium |
| SMILES | CC1(C)c2ccccc2-c2c[c-]c(-c3ccc4ccccc4n3)cc21.[H]/[O+]=C(/C=C(/C)O)Oc1ccc(C(C)CC)cc1.[Ir] |
| InChI | InChI=1S/C24H18N.C14H18O3.Ir/c1-24(2)20-9-5-4-8-18(20)19-13-11-17(15-21(19)24)23-14-12-16-7-3-6-10-22(16)25-23;1-4-10(2)12-5-7-13(8-6-12)17-14(16)9-11(3)15;/h3-10,12-15H,1-2H3;5-10,15H,4H2,1-3H3;/q-1;;/p+1/b;11-9-; |
| InChIKey | LCSMPGPOCFBGGO-UTAAMMLDSA-O |
| XLogP | 9.55 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.94 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|