C19H24N2O2 — CID 59803285
(4E,6E)-1-(4-acetylpiperazin-1-yl)-7-phenylhepta-4,6-dien-3-one (PubChem CID 59803285) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (4E,6E)-1-(4-acetylpiperazin-1-yl)-7-phenylhepta-4,6-dien-3-one.
| Compound Name | (4E,6E)-1-(4-acetylpiperazin-1-yl)-7-phenylhepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 59803285 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (4E,6E)-1-(4-acetylpiperazin-1-yl)-7-phenylhepta-4,6-dien-3-one |
| SMILES | CC(=O)N1CCN(CCC(=O)/C=C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C19H24N2O2/c1-17(22)21-15-13-20(14-16-21)12-11-19(23)10-6-5-9-18-7-3-2-4-8-18/h2-10H,11-16H2,1H3/b9-5+,10-6+ |
| InChIKey | XEZBFKCAGAPZLV-NXZHAISVSA-N |
| XLogP | 2.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|