C35H47NO4 — CID 59805041
methyl 2-[[(2E,6E,8E,10E,12E,14E,16E,18E,20E,22E)-2,6,10,14,19,23-hexamethylpentacosa-2,6,8,10,12,14,16,18,20,22,24-undecaenoxy]carbonylamino]acetate (PubChem CID 59805041) has the molecular formula C35H47NO4 and a molecular weight of 545.76 g/mol. Its IUPAC name is methyl 2-[[(2E,6E,8E,10E,12E,14E,16E,18E,20E,22E)-2,6,10,14,19,23-hexamethylpentacosa-2,6,8,10,12,14,16,18,20,22,24-undecaenoxy]carbonylamino]acetate.
| Compound Name | methyl 2-[[(2E,6E,8E,10E,12E,14E,16E,18E,20E,22E)-2,6,10,14,19,23-hexamethylpentacosa-2,6,8,10,12,14,16,18,20,22,24-undecaenoxy]carbonylamino]acetate |
|---|---|
| PubChem CID | 59805041 |
| Molecular Formula | C35H47NO4 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | methyl 2-[[(2E,6E,8E,10E,12E,14E,16E,18E,20E,22E)-2,6,10,14,19,23-hexamethylpentacosa-2,6,8,10,12,14,16,18,20,22,24-undecaenoxy]carbonylamino]acetate |
| SMILES | C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(\C)CC/C=C(\C)COC(=O)NCC(=O)OC |
| InChI | InChI=1S/C35H47NO4/c1-9-28(2)18-12-19-29(3)16-10-11-17-30(4)20-13-21-31(5)22-14-23-32(6)24-15-25-33(7)27-40-35(38)36-26-34(37)39-8/h9-14,16-23,25H,1,15,24,26-27H2,2-8H3,(H,36,38)/b11-10+,19-12+,20-13+,22-14+,28-18+,29-16+,30-17+,31-21+,32-23+,33-25+ |
| InChIKey | WCTFDBMIKQRJEX-NIHAHCDJSA-N |
| XLogP | 8.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|