C14H15NY-2 — CID 59809548
aniline;1,4-dimethylbenzene-6-ide;yttrium (PubChem CID 59809548) has the molecular formula C14H15NY-2 and a molecular weight of 286.19 g/mol. Its IUPAC name is aniline;1,4-dimethylbenzene-6-ide;yttrium.
| Compound Name | aniline;1,4-dimethylbenzene-6-ide;yttrium |
|---|---|
| PubChem CID | 59809548 |
| Molecular Formula | C14H15NY-2 |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | aniline;1,4-dimethylbenzene-6-ide;yttrium |
| SMILES | Cc1[c-]cc(C)cc1.Nc1[c-]cccc1.[Y] |
| InChI | InChI=1S/C8H9.C6H6N.Y/c1-7-3-5-8(2)6-4-7;7-6-4-2-1-3-5-6;/h3-5H,1-2H3;1-4H,7H2;/q2*-1; |
| InChIKey | BJCUSXRLHWNBFA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|