C9H10FN — CID 145436775
(1E,3E,5Z,7E)-8-fluoro-4-methylcycloocta-1,3,5,7-tetraen-1-amine (PubChem CID 145436775) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is (1E,3E,5Z,7E)-8-fluoro-4-methylcycloocta-1,3,5,7-tetraen-1-amine.
| Compound Name | (1E,3E,5Z,7E)-8-fluoro-4-methylcycloocta-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 145436775 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (1E,3E,5Z,7E)-8-fluoro-4-methylcycloocta-1,3,5,7-tetraen-1-amine |
| SMILES | CC1=C/C=C(N)\C(F)=C/C=C\1 |
| InChI | InChI=1S/C9H10FN/c1-7-3-2-4-8(10)9(11)6-5-7/h2-6H,11H2,1H3/b3-2-,4-2-,6-5-,7-3-,7-5-,8-4+,9-6+,9-8- |
| InChIKey | CPCVHDJAHTZIFM-HZJOTAGCSA-N |
| XLogP | 2.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |