C26H27N5O4S2 — CID 59818327
(2S)-N-hydroxy-1-[3-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]-(thiophene-2-carbonyl)amino]propyl]piperidine-2-carboxamide (PubChem CID 59818327) has the molecular formula C26H27N5O4S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is (2S)-N-hydroxy-1-[3-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]-(thiophene-2-carbonyl)amino]propyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-hydroxy-1-[3-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]-(thiophene-2-carbonyl)amino]propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 59818327 |
| Molecular Formula | C26H27N5O4S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | (2S)-N-hydroxy-1-[3-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]-(thiophene-2-carbonyl)amino]propyl]piperidine-2-carboxamide |
| SMILES | O=C(NO)[C@@H]1CCCCN1CCCN(C(=O)c1cccs1)c1nc(-c2cc(-c3ccccc3)no2)cs1 |
| InChI | InChI=1S/C26H27N5O4S2/c32-24(28-34)21-10-4-5-12-30(21)13-7-14-31(25(33)23-11-6-15-36-23)26-27-20(17-37-26)22-16-19(29-35-22)18-8-2-1-3-9-18/h1-3,6,8-9,11,15-17,21,34H,4-5,7,10,12-14H2,(H,28,32)/t21-/m0/s1 |
| InChIKey | HAEIGNXGLTXKDX-NRFANRHFSA-N |
| XLogP | 4.92 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|