C24H32O4 — CID 59819574
(1R,2S,11S,12S,15R,16S,18S)-15-acetyl-15-ethoxy-18-hydroxy-2,16-dimethylpentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one (PubChem CID 59819574) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (1R,2S,11S,12S,15R,16S,18S)-15-acetyl-15-ethoxy-18-hydroxy-2,16-dimethylpentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one.
| Compound Name | (1R,2S,11S,12S,15R,16S,18S)-15-acetyl-15-ethoxy-18-hydroxy-2,16-dimethylpentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one |
|---|---|
| PubChem CID | 59819574 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (1R,2S,11S,12S,15R,16S,18S)-15-acetyl-15-ethoxy-18-hydroxy-2,16-dimethylpentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one |
| SMILES | CCO[C@]1(C(C)=O)CC[C@H]2[C@@H]3C=CC4=CC(=O)C5CC5[C@@]4(C)[C@@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C24H32O4/c1-5-28-24(13(2)25)9-8-17-15-7-6-14-10-19(26)16-11-18(16)23(14,4)21(15)20(27)12-22(17,24)3/h6-7,10,15-18,20-21,27H,5,8-9,11-12H2,1-4H3/t15-,16?,17-,18?,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | KBTTYRRUHIMRMH-ORQRSYISSA-N |
| XLogP | 3.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |