C25H35N3O5S — CID 59820078
N-[5-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-5-oxopentyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide (PubChem CID 59820078) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is N-[5-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-5-oxopentyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-[5-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-5-oxopentyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 59820078 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-[5-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-5-oxopentyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCCCC(=O)N2CCC(O)(c3cccnc3)CC2)c(C)c1 |
| InChI | InChI=1S/C25H35N3O5S/c1-19-16-22(33-4)17-20(2)24(19)34(31,32)27(3)13-6-5-9-23(29)28-14-10-25(30,11-15-28)21-8-7-12-26-18-21/h7-8,12,16-18,30H,5-6,9-11,13-15H2,1-4H3 |
| InChIKey | CTJQNKFTKYLARG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|