C20H29N2O3- — CID 59828845
1-[(2-methylpropan-2-yl)oxy]-N-[[4-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]phenyl]methyl]methanimidate (PubChem CID 59828845) has the molecular formula C20H29N2O3- and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]-N-[[4-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]phenyl]methyl]methanimidate.
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]-N-[[4-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]phenyl]methyl]methanimidate |
|---|---|
| PubChem CID | 59828845 |
| Molecular Formula | C20H29N2O3- |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]-N-[[4-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]phenyl]methyl]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/Cc1ccc(NC(=O)C2C(C)(C)C2(C)C)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-18(2,3)25-17(24)21-12-13-8-10-14(11-9-13)22-16(23)15-19(4,5)20(15,6)7/h8-11,15H,12H2,1-7H3,(H,21,24)(H,22,23)/p-1 |
| InChIKey | ZECMDFWXHVHCFO-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|