C13H19NO2 — CID 59830047
(3S,4S)-1-methanidyl-4-methoxy-4-phenylpiperidin-1-ium-3-ol (PubChem CID 59830047) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3S,4S)-1-methanidyl-4-methoxy-4-phenylpiperidin-1-ium-3-ol.
| Compound Name | (3S,4S)-1-methanidyl-4-methoxy-4-phenylpiperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 59830047 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3S,4S)-1-methanidyl-4-methoxy-4-phenylpiperidin-1-ium-3-ol |
| SMILES | [CH2-][NH+]1CC[C@](OC)(c2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C13H19NO2/c1-14-9-8-13(16-2,12(15)10-14)11-6-4-3-5-7-11/h3-7,12,14-15H,1,8-10H2,2H3/t12-,13-/m0/s1 |
| InChIKey | ZOHWEMXYYSISCK-STQMWFEESA-N |
| XLogP | -0.03 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|