C28H37N5O3 — CID 59830255
tert-butyl N-[3-[3-[[1-(naphthalen-2-ylmethyl)piperidin-4-yl]amino]-2-oxopyrazin-1-yl]propyl]carbamate (PubChem CID 59830255) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[1-(naphthalen-2-ylmethyl)piperidin-4-yl]amino]-2-oxopyrazin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[1-(naphthalen-2-ylmethyl)piperidin-4-yl]amino]-2-oxopyrazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 59830255 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | tert-butyl N-[3-[3-[[1-(naphthalen-2-ylmethyl)piperidin-4-yl]amino]-2-oxopyrazin-1-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCn1ccnc(NC2CCN(Cc3ccc4ccccc4c3)CC2)c1=O |
| InChI | InChI=1S/C28H37N5O3/c1-28(2,3)36-27(35)30-13-6-15-33-18-14-29-25(26(33)34)31-24-11-16-32(17-12-24)20-21-9-10-22-7-4-5-8-23(22)19-21/h4-5,7-10,14,18-19,24H,6,11-13,15-17,20H2,1-3H3,(H,29,31)(H,30,35) |
| InChIKey | HRFJBGPFCKQERH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|