C24H31FN2O — CID 59830597
5-[4-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-1-(2-fluoroethyl)-2-methylidenepyridine (PubChem CID 59830597) has the molecular formula C24H31FN2O and a molecular weight of 382.52 g/mol. Its IUPAC name is 5-[4-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-1-(2-fluoroethyl)-2-methylidenepyridine.
| Compound Name | 5-[4-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-1-(2-fluoroethyl)-2-methylidenepyridine |
|---|---|
| PubChem CID | 59830597 |
| Molecular Formula | C24H31FN2O |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 5-[4-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-1-(2-fluoroethyl)-2-methylidenepyridine |
| SMILES | C=C1C=CC(c2ccc(OC3CCN(C4CCCC4)CC3)cc2)=CN1CCF |
| InChI | InChI=1S/C24H31FN2O/c1-19-6-7-21(18-27(19)17-14-25)20-8-10-23(11-9-20)28-24-12-15-26(16-13-24)22-4-2-3-5-22/h6-11,18,22,24H,1-5,12-17H2 |
| InChIKey | FJBHIPKMNHSSGE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |