C26H29N4O5PS — CID 59835634
N-(dimethylphosphorylmethyl)-9-[4-(methanesulfonamido)-2-methoxyanilino]-5-methylacridine-4-carboxamide (PubChem CID 59835634) has the molecular formula C26H29N4O5PS and a molecular weight of 540.58 g/mol. Its IUPAC name is N-(dimethylphosphorylmethyl)-9-[4-(methanesulfonamido)-2-methoxyanilino]-5-methylacridine-4-carboxamide.
| Compound Name | N-(dimethylphosphorylmethyl)-9-[4-(methanesulfonamido)-2-methoxyanilino]-5-methylacridine-4-carboxamide |
|---|---|
| PubChem CID | 59835634 |
| Molecular Formula | C26H29N4O5PS |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-(dimethylphosphorylmethyl)-9-[4-(methanesulfonamido)-2-methoxyanilino]-5-methylacridine-4-carboxamide |
| SMILES | COc1cc(NS(C)(=O)=O)ccc1Nc1c2cccc(C)c2nc2c(C(=O)NCP(C)(C)=O)cccc12 |
| InChI | InChI=1S/C26H29N4O5PS/c1-16-8-6-9-18-23(16)29-25-19(10-7-11-20(25)26(31)27-15-36(3,4)32)24(18)28-21-13-12-17(14-22(21)35-2)30-37(5,33)34/h6-14,30H,15H2,1-5H3,(H,27,31)(H,28,29) |
| InChIKey | HTZUFMXGNBRPDT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|