C24H24N4O4S — CID 70691398
9-[4-(methanesulfonamido)-2-methoxy-N-methylanilino]-5-methylacridine-4-carboxamide (PubChem CID 70691398) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 9-[4-(methanesulfonamido)-2-methoxy-N-methylanilino]-5-methylacridine-4-carboxamide.
| Compound Name | 9-[4-(methanesulfonamido)-2-methoxy-N-methylanilino]-5-methylacridine-4-carboxamide |
|---|---|
| PubChem CID | 70691398 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 9-[4-(methanesulfonamido)-2-methoxy-N-methylanilino]-5-methylacridine-4-carboxamide |
| SMILES | COc1cc(NS(C)(=O)=O)ccc1N(C)c1c2cccc(C)c2nc2c(C(N)=O)cccc12 |
| InChI | InChI=1S/C24H24N4O4S/c1-14-7-5-8-16-21(14)26-22-17(9-6-10-18(22)24(25)29)23(16)28(2)19-12-11-15(13-20(19)32-3)27-33(4,30)31/h5-13,27H,1-4H3,(H2,25,29) |
| InChIKey | SCWLIXGHDZIONF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|