C23H30N4O — CID 59841066
2-[1-amino-4-(diethylamino)butyl]-5-methyl-3-phenylquinazolin-4-one (PubChem CID 59841066) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-[1-amino-4-(diethylamino)butyl]-5-methyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[1-amino-4-(diethylamino)butyl]-5-methyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 59841066 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-[1-amino-4-(diethylamino)butyl]-5-methyl-3-phenylquinazolin-4-one |
| SMILES | CCN(CC)CCCC(N)c1nc2cccc(C)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H30N4O/c1-4-26(5-2)16-10-14-19(24)22-25-20-15-9-11-17(3)21(20)23(28)27(22)18-12-7-6-8-13-18/h6-9,11-13,15,19H,4-5,10,14,16,24H2,1-3H3 |
| InChIKey | LMEDSYXNSPVVDX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |