C32H25N3O — CID 59841044
2-[1-(benzhydrylideneamino)but-3-ynyl]-5-methyl-3-phenylquinazolin-4-one (PubChem CID 59841044) has the molecular formula C32H25N3O and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[1-(benzhydrylideneamino)but-3-ynyl]-5-methyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[1-(benzhydrylideneamino)but-3-ynyl]-5-methyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 59841044 |
| Molecular Formula | C32H25N3O |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 2-[1-(benzhydrylideneamino)but-3-ynyl]-5-methyl-3-phenylquinazolin-4-one |
| SMILES | C#CCC(N=C(c1ccccc1)c1ccccc1)c1nc2cccc(C)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C32H25N3O/c1-3-14-28(33-30(24-16-7-4-8-17-24)25-18-9-5-10-19-25)31-34-27-22-13-15-23(2)29(27)32(36)35(31)26-20-11-6-12-21-26/h1,4-13,15-22,28H,14H2,2H3 |
| InChIKey | CNQGMFKVXGYINO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|