C25H20Cl2N4O5S — CID 59846918
5-[(4R)-4-[4-chloro-3-(2-chloro-6-isocyanophenoxy)phenyl]-2-oxopyrrolidin-1-yl]-2-(methanesulfonamido)benzamide (PubChem CID 59846918) has the molecular formula C25H20Cl2N4O5S and a molecular weight of 559.43 g/mol. Its IUPAC name is 5-[(4R)-4-[4-chloro-3-(2-chloro-6-isocyanophenoxy)phenyl]-2-oxopyrrolidin-1-yl]-2-(methanesulfonamido)benzamide.
| Compound Name | 5-[(4R)-4-[4-chloro-3-(2-chloro-6-isocyanophenoxy)phenyl]-2-oxopyrrolidin-1-yl]-2-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 59846918 |
| Molecular Formula | C25H20Cl2N4O5S |
| Molecular Weight | 559.43 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | 5-[(4R)-4-[4-chloro-3-(2-chloro-6-isocyanophenoxy)phenyl]-2-oxopyrrolidin-1-yl]-2-(methanesulfonamido)benzamide |
| SMILES | [C-]#[N+]c1cccc(Cl)c1Oc1cc([C@H]2CC(=O)N(c3ccc(NS(C)(=O)=O)c(C(N)=O)c3)C2)ccc1Cl |
| InChI | InChI=1S/C25H20Cl2N4O5S/c1-29-21-5-3-4-19(27)24(21)36-22-10-14(6-8-18(22)26)15-11-23(32)31(13-15)16-7-9-20(30-37(2,34)35)17(12-16)25(28)33/h3-10,12,15,30H,11,13H2,2H3,(H2,28,33)/t15-/m0/s1 |
| InChIKey | SPOYHDRNNPQMHT-HNNXBMFYSA-N |
| XLogP | 5.33 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|