C26H18Cl2N4O2 — CID 59846922
(4R)-1-(1-aminoisoquinolin-7-yl)-4-[4-chloro-3-(2-chloro-6-isocyanophenoxy)phenyl]pyrrolidin-2-one (PubChem CID 59846922) has the molecular formula C26H18Cl2N4O2 and a molecular weight of 489.36 g/mol. Its IUPAC name is (4R)-1-(1-aminoisoquinolin-7-yl)-4-[4-chloro-3-(2-chloro-6-isocyanophenoxy)phenyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-(1-aminoisoquinolin-7-yl)-4-[4-chloro-3-(2-chloro-6-isocyanophenoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 59846922 |
| Molecular Formula | C26H18Cl2N4O2 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | (4R)-1-(1-aminoisoquinolin-7-yl)-4-[4-chloro-3-(2-chloro-6-isocyanophenoxy)phenyl]pyrrolidin-2-one |
| SMILES | [C-]#[N+]c1cccc(Cl)c1Oc1cc([C@H]2CC(=O)N(c3ccc4ccnc(N)c4c3)C2)ccc1Cl |
| InChI | InChI=1S/C26H18Cl2N4O2/c1-30-22-4-2-3-21(28)25(22)34-23-11-16(6-8-20(23)27)17-12-24(33)32(14-17)18-7-5-15-9-10-31-26(29)19(15)13-18/h2-11,13,17H,12,14H2,(H2,29,31)/t17-/m0/s1 |
| InChIKey | HKZVSNQVSMTSGK-KRWDZBQOSA-N |
| XLogP | 6.99 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|