C27H44O5Y — CID 59847076
(1S,2S,4S,7S,8S,9S,12S,13R,16S)-6-(4-methoxy-3-methylbutyl)-9,13-dimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,7,16-triol;yttrium (PubChem CID 59847076) has the molecular formula C27H44O5Y and a molecular weight of 537.55 g/mol. Its IUPAC name is (1S,2S,4S,7S,8S,9S,12S,13R,16S)-6-(4-methoxy-3-methylbutyl)-9,13-dimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,7,16-triol;yttrium.
| Compound Name | (1S,2S,4S,7S,8S,9S,12S,13R,16S)-6-(4-methoxy-3-methylbutyl)-9,13-dimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,7,16-triol;yttrium |
|---|---|
| PubChem CID | 59847076 |
| Molecular Formula | C27H44O5Y |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | (1S,2S,4S,7S,8S,9S,12S,13R,16S)-6-(4-methoxy-3-methylbutyl)-9,13-dimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,7,16-triol;yttrium |
| SMILES | COCC(C)CCC1(O)O[C@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2[C@@H]1O.[Y] |
| InChI | InChI=1S/C27H44O5.Y/c1-16(15-31-4)7-12-27(30)24(29)23-22(32-27)14-21-19-6-5-17-13-18(28)8-10-25(17,2)20(19)9-11-26(21,23)3;/h5,16,18-24,28-30H,6-15H2,1-4H3;/t16?,18-,19+,20-,21-,22-,23+,24-,25-,26-,27?;/m0./s1 |
| InChIKey | BAFVUAKLHYUYQX-XVNFBRBTSA-N |
| XLogP | 4.04 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|