About 2-quinolin-3-ylguanidine
2-quinolin-3-ylguanidine (PubChem CID 59852075) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 2-quinolin-3-ylguanidine.
Molecular Properties
| Compound Name | 2-quinolin-3-ylguanidine |
| PubChem CID | 59852075 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-quinolin-3-ylguanidine |
| SMILES | NC(N)=Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C10H10N4/c11-10(12)14-8-5-7-3-1-2-4-9(7)13-6-8/h1-6H,(H4,11,12,14) |
| InChIKey | LHKXHMYXVQVCMI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-quinolin-3-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-3-ylguanidine?
The IUPAC name of 2-quinolin-3-ylguanidine (CID 59852075) is 2-quinolin-3-ylguanidine.
What is the SMILES notation for 2-quinolin-3-ylguanidine?
The canonical SMILES for 2-quinolin-3-ylguanidine is NC(N)=Nc1cnc2ccccc2c1.
What is the InChIKey of 2-quinolin-3-ylguanidine?
The InChIKey is LHKXHMYXVQVCMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c11-10(12)14-8-5-7-3-1-2-4-9(7)13-6-8/h1-6H,(H4,11,12,14).
What are the key properties of 2-quinolin-3-ylguanidine?
2-quinolin-3-ylguanidine has a molecular weight of 186.22 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-3-ylguanidine is sourced from PubChem (CID 59852075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).