About nickel;quinoline-3-thiol;sulfanide
nickel;quinoline-3-thiol;sulfanide (PubChem CID 175270394) has the molecular formula C9H8NNiS2-
and a molecular weight of 253.00 g/mol. Its IUPAC name is nickel;quinoline-3-thiol;sulfanide.
Molecular Properties
| Compound Name | nickel;quinoline-3-thiol;sulfanide |
| PubChem CID | 175270394 |
| Molecular Formula | C9H8NNiS2- |
| Molecular Weight | 253.00 g/mol |
| Exact Mass | 251.95 |
| IUPAC Name | nickel;quinoline-3-thiol;sulfanide |
| SMILES | Sc1cnc2ccccc2c1.[Ni].[SH-] |
| InChI | InChI=1S/C9H7NS.Ni.H2S/c11-8-5-7-3-1-2-4-9(7)10-6-8;;/h1-6,11H;;1H2/p-1 |
| InChIKey | VMNSLOOGDXWSBX-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.00 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze nickel;quinoline-3-thiol;sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;quinoline-3-thiol;sulfanide?
The IUPAC name of nickel;quinoline-3-thiol;sulfanide (CID 175270394) is nickel;quinoline-3-thiol;sulfanide.
What is the SMILES notation for nickel;quinoline-3-thiol;sulfanide?
The canonical SMILES for nickel;quinoline-3-thiol;sulfanide is Sc1cnc2ccccc2c1.[Ni].[SH-].
What is the InChIKey of nickel;quinoline-3-thiol;sulfanide?
The InChIKey is VMNSLOOGDXWSBX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7NS.Ni.H2S/c11-8-5-7-3-1-2-4-9(7)10-6-8;;/h1-6,11H;;1H2/p-1.
What are the key properties of nickel;quinoline-3-thiol;sulfanide?
nickel;quinoline-3-thiol;sulfanide has a molecular weight of 253.00 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;quinoline-3-thiol;sulfanide is sourced from PubChem (CID 175270394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).