C26H23N3O7 — CID 59870408
4-[(5Z)-3-ethyl-5-[[1-(1-methoxy-1-oxopropan-2-yl)indol-3-yl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoic acid (PubChem CID 59870408) has the molecular formula C26H23N3O7 and a molecular weight of 489.48 g/mol. Its IUPAC name is 4-[(5Z)-3-ethyl-5-[[1-(1-methoxy-1-oxopropan-2-yl)indol-3-yl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 4-[(5Z)-3-ethyl-5-[[1-(1-methoxy-1-oxopropan-2-yl)indol-3-yl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 59870408 |
| Molecular Formula | C26H23N3O7 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 4-[(5Z)-3-ethyl-5-[[1-(1-methoxy-1-oxopropan-2-yl)indol-3-yl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoic acid |
| SMILES | CCN1C(=O)/C(=C/c2cn(C(C)C(=O)OC)c3ccccc23)C(=O)N(c2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C26H23N3O7/c1-4-27-22(30)20(23(31)29(26(27)35)18-11-9-16(10-12-18)24(32)33)13-17-14-28(15(2)25(34)36-3)21-8-6-5-7-19(17)21/h5-15H,4H2,1-3H3,(H,32,33)/b20-13- |
| InChIKey | RDGRPOVPMGHRMV-MOSHPQCFSA-N |
| XLogP | 3.47 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|