C24H23N3O7 — CID 4023764
methyl 5-[[4-[[1-(1-ethoxy-1-oxopropan-2-yl)indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 4023764) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is methyl 5-[[4-[[1-(1-ethoxy-1-oxopropan-2-yl)indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[1-(1-ethoxy-1-oxopropan-2-yl)indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4023764 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | methyl 5-[[4-[[1-(1-ethoxy-1-oxopropan-2-yl)indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)C(C)n1cc(C=C2NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H23N3O7/c1-4-33-22(29)14(2)26-12-15(17-7-5-6-8-19(17)26)11-18-21(28)27(24(31)25-18)13-16-9-10-20(34-16)23(30)32-3/h5-12,14H,4,13H2,1-3H3,(H,25,31) |
| InChIKey | JAOHADUTHXWEGX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|