C12H14N2 — CID 598733
2-(3,4,5,5-tetramethylcyclopent-2-en-1-ylidene)propanedinitrile (PubChem CID 598733) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(3,4,5,5-tetramethylcyclopent-2-en-1-ylidene)propanedinitrile.
| Compound Name | 2-(3,4,5,5-tetramethylcyclopent-2-en-1-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 598733 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-(3,4,5,5-tetramethylcyclopent-2-en-1-ylidene)propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C(C)(C)C1C |
| InChI | InChI=1S/C12H14N2/c1-8-5-11(10(6-13)7-14)12(3,4)9(8)2/h5,9H,1-4H3 |
| InChIKey | KRZFQWIGHATZPS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|