C28H20N2O6 — CID 59875861
4-[(4-carboxy-1-methylquinolin-1-ium-2-yl)methylidene]-2-[(4-carboxy-1-methylquinolin-2-ylidene)methyl]-3-oxocyclobuten-1-olate (PubChem CID 59875861) has the molecular formula C28H20N2O6 and a molecular weight of 480.48 g/mol. Its IUPAC name is 4-[(4-carboxy-1-methylquinolin-1-ium-2-yl)methylidene]-2-[(4-carboxy-1-methylquinolin-2-ylidene)methyl]-3-oxocyclobuten-1-olate.
| Compound Name | 4-[(4-carboxy-1-methylquinolin-1-ium-2-yl)methylidene]-2-[(4-carboxy-1-methylquinolin-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 59875861 |
| Molecular Formula | C28H20N2O6 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 4-[(4-carboxy-1-methylquinolin-1-ium-2-yl)methylidene]-2-[(4-carboxy-1-methylquinolin-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
| SMILES | CN1C(=CC2=C([O-])C(=Cc3cc(C(=O)O)c4ccccc4[n+]3C)C2=O)C=C(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C28H20N2O6/c1-29-15(11-19(27(33)34)17-7-3-5-9-23(17)29)13-21-25(31)22(26(21)32)14-16-12-20(28(35)36)18-8-4-6-10-24(18)30(16)2/h3-14H,1-2H3,(H2-,31,32,33,34,35,36) |
| InChIKey | CIDQAAWKIQFHKV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|