C12H17IN2O5 — CID 59878083
1-[5-(hydroxymethyl)-4-methoxy-3,3-dimethyloxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 59878083) has the molecular formula C12H17IN2O5 and a molecular weight of 396.18 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)-4-methoxy-3,3-dimethyloxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[5-(hydroxymethyl)-4-methoxy-3,3-dimethyloxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59878083 |
| Molecular Formula | C12H17IN2O5 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 1-[5-(hydroxymethyl)-4-methoxy-3,3-dimethyloxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | COC1C(CO)OC(n2cc(I)c(=O)[nH]c2=O)C1(C)C |
| InChI | InChI=1S/C12H17IN2O5/c1-12(2)8(19-3)7(5-16)20-10(12)15-4-6(13)9(17)14-11(15)18/h4,7-8,10,16H,5H2,1-3H3,(H,14,17,18) |
| InChIKey | LQJLBOGDSWBBJM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|