C16H14FIN2O7 — CID 67944010
[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate (PubChem CID 67944010) has the molecular formula C16H14FIN2O7 and a molecular weight of 492.20 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 67944010 |
| Molecular Formula | C16H14FIN2O7 |
| Molecular Weight | 492.20 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | [(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
| SMILES | O=C(O[C@]1(F)[C@H](O)[C@@H](CO)O[C@H]1n1cc(I)c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C16H14FIN2O7/c17-16(27-13(24)8-4-2-1-3-5-8)11(22)10(7-21)26-14(16)20-6-9(18)12(23)19-15(20)25/h1-6,10-11,14,21-22H,7H2,(H,19,23,25)/t10-,11-,14-,16-/m1/s1 |
| InChIKey | NHSIMNOFASGXGR-MMYVAXCBSA-N |
| XLogP | -0.09 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|