C16H22BNO6 — CID 59879361
(7R,9S)-3-[aminooxy(methyl)boranyl]-7-benzyl-8-hydroxy-9-methyl-1,5-dioxonane-2,6-dione (PubChem CID 59879361) has the molecular formula C16H22BNO6 and a molecular weight of 335.17 g/mol. Its IUPAC name is (7R,9S)-3-[aminooxy(methyl)boranyl]-7-benzyl-8-hydroxy-9-methyl-1,5-dioxonane-2,6-dione.
| Compound Name | (7R,9S)-3-[aminooxy(methyl)boranyl]-7-benzyl-8-hydroxy-9-methyl-1,5-dioxonane-2,6-dione |
|---|---|
| PubChem CID | 59879361 |
| Molecular Formula | C16H22BNO6 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (7R,9S)-3-[aminooxy(methyl)boranyl]-7-benzyl-8-hydroxy-9-methyl-1,5-dioxonane-2,6-dione |
| SMILES | CB(ON)C1COC(=O)[C@H](Cc2ccccc2)C(O)[C@H](C)OC1=O |
| InChI | InChI=1S/C16H22BNO6/c1-10-14(19)12(8-11-6-4-3-5-7-11)15(20)22-9-13(16(21)23-10)17(2)24-18/h3-7,10,12-14,19H,8-9,18H2,1-2H3/t10-,12+,13?,14?/m0/s1 |
| InChIKey | GHUAVUAVDSWYEU-WHNWWWKISA-N |
| XLogP | 0.58 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|