C22H32 — CID 59880402
(3E)-3-[(E)-but-2-enylidene]-6-(2-deuterioethenyl)-1,1,4,5,8,8-hexamethyl-7,8a-dihydro-2H-naphthalene (PubChem CID 59880402) has the molecular formula C22H32 and a molecular weight of 297.50 g/mol. Its IUPAC name is (3E)-3-[(E)-but-2-enylidene]-6-(2-deuterioethenyl)-1,1,4,5,8,8-hexamethyl-7,8a-dihydro-2H-naphthalene.
| Compound Name | (3E)-3-[(E)-but-2-enylidene]-6-(2-deuterioethenyl)-1,1,4,5,8,8-hexamethyl-7,8a-dihydro-2H-naphthalene |
|---|---|
| PubChem CID | 59880402 |
| Molecular Formula | C22H32 |
| Molecular Weight | 297.50 g/mol |
| Exact Mass | 297.26 |
| IUPAC Name | (3E)-3-[(E)-but-2-enylidene]-6-(2-deuterioethenyl)-1,1,4,5,8,8-hexamethyl-7,8a-dihydro-2H-naphthalene |
| SMILES | [2H]/C=C/C1=C(C)C2=C(C)/C(=C/C=C/C)CC(C)(C)C2C(C)(C)C1 |
| InChI | InChI=1S/C22H32/c1-9-11-12-18-14-22(7,8)20-19(16(18)4)15(3)17(10-2)13-21(20,5)6/h9-12,20H,2,13-14H2,1,3-8H3/b11-9+,18-12+/i2D/b10-2+,11-9+,18-12+ |
| InChIKey | OGTJEAJEVPCVFN-MBWBISEYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.50 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |