C21H32O6 — CID 59881735
(3E,4S)-3-[2-[(5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]ethylidene]-4-methoxyoxolan-2-one (PubChem CID 59881735) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (3E,4S)-3-[2-[(5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]ethylidene]-4-methoxyoxolan-2-one.
| Compound Name | (3E,4S)-3-[2-[(5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]ethylidene]-4-methoxyoxolan-2-one |
|---|---|
| PubChem CID | 59881735 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (3E,4S)-3-[2-[(5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]ethylidene]-4-methoxyoxolan-2-one |
| SMILES | CO[C@@H]1COC(=O)/C1=C/CC1C2(CCC3[C@]1(C)CC[C@@H](O)[C@@]3(C)CO)CO2 |
| InChI | InChI=1S/C21H32O6/c1-19-8-7-17(23)20(2,11-22)15(19)6-9-21(12-27-21)16(19)5-4-13-14(25-3)10-26-18(13)24/h4,14-17,22-23H,5-12H2,1-3H3/b13-4+/t14-,15?,16?,17-,19+,20+,21?/m1/s1 |
| InChIKey | SOHIUZBBLMMPMZ-RMGGQGIHSA-N |
| XLogP | 1.83 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|