C23H34O6 — CID 90916947
(4S)-3-[2-[(4aR,6aS,10bR)-3,3,6a,10b-tetramethylspiro[1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxine-8,2'-oxirane]-7-yl]ethylidene]-4-hydroxyoxolan-2-one (PubChem CID 90916947) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is (4S)-3-[2-[(4aR,6aS,10bR)-3,3,6a,10b-tetramethylspiro[1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxine-8,2'-oxirane]-7-yl]ethylidene]-4-hydroxyoxolan-2-one.
| Compound Name | (4S)-3-[2-[(4aR,6aS,10bR)-3,3,6a,10b-tetramethylspiro[1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxine-8,2'-oxirane]-7-yl]ethylidene]-4-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 90916947 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (4S)-3-[2-[(4aR,6aS,10bR)-3,3,6a,10b-tetramethylspiro[1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxine-8,2'-oxirane]-7-yl]ethylidene]-4-hydroxyoxolan-2-one |
| SMILES | CC1(C)OC[C@@]2(C)C3CCC4(CO4)C(CC=C4C(=O)OC[C@H]4O)[C@@]3(C)CC[C@H]2O1 |
| InChI | InChI=1S/C23H34O6/c1-20(2)27-12-22(4)16-7-10-23(13-28-23)17(21(16,3)9-8-18(22)29-20)6-5-14-15(24)11-26-19(14)25/h5,15-18,24H,6-13H2,1-4H3/t15-,16?,17?,18-,21+,22+,23?/m1/s1 |
| InChIKey | CMDWEXHDIPBFKK-GMFAGCIJSA-N |
| XLogP | 2.97 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|