C25H40O6 — CID 59897209
(3E,4S)-3-[2-[(5R,6R,8aS)-6-ethoxy-5-(ethoxymethyl)-5,8a-dimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]ethylidene]-4-methoxyoxolan-2-one (PubChem CID 59897209) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is (3E,4S)-3-[2-[(5R,6R,8aS)-6-ethoxy-5-(ethoxymethyl)-5,8a-dimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]ethylidene]-4-methoxyoxolan-2-one.
| Compound Name | (3E,4S)-3-[2-[(5R,6R,8aS)-6-ethoxy-5-(ethoxymethyl)-5,8a-dimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]ethylidene]-4-methoxyoxolan-2-one |
|---|---|
| PubChem CID | 59897209 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (3E,4S)-3-[2-[(5R,6R,8aS)-6-ethoxy-5-(ethoxymethyl)-5,8a-dimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]ethylidene]-4-methoxyoxolan-2-one |
| SMILES | CCOC[C@@]1(C)C2CCC3(CO3)C(C/C=C3/C(=O)OC[C@H]3OC)[C@@]2(C)CC[C@H]1OCC |
| InChI | InChI=1S/C25H40O6/c1-6-28-15-24(4)19-10-13-25(16-31-25)20(23(19,3)12-11-21(24)29-7-2)9-8-17-18(27-5)14-30-22(17)26/h8,18-21H,6-7,9-16H2,1-5H3/b17-8+/t18-,19?,20?,21-,23+,24+,25?/m1/s1 |
| InChIKey | DDWQGTIBSRONIW-UWIGMCJMSA-N |
| XLogP | 3.92 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|