C18H19N3O3 — CID 59882812
N-(methoxymethyl)-2,4,7-trimethyl-1-nitroacridin-9-amine (PubChem CID 59882812) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-(methoxymethyl)-2,4,7-trimethyl-1-nitroacridin-9-amine.
| Compound Name | N-(methoxymethyl)-2,4,7-trimethyl-1-nitroacridin-9-amine |
|---|---|
| PubChem CID | 59882812 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(methoxymethyl)-2,4,7-trimethyl-1-nitroacridin-9-amine |
| SMILES | COCNc1c2cc(C)ccc2nc2c(C)cc(C)c([N+](=O)[O-])c12 |
| InChI | InChI=1S/C18H19N3O3/c1-10-5-6-14-13(7-10)17(19-9-24-4)15-16(20-14)11(2)8-12(3)18(15)21(22)23/h5-8H,9H2,1-4H3,(H,19,20) |
| InChIKey | ZPUPDCWLYYGNIA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|