C18H15N2O5SY- — CID 59885751
[4-[(8-hydroxy-7-methyl-3-sulfonaphthalen-1-yl)carbamoyl]phenyl]azanide;yttrium (PubChem CID 59885751) has the molecular formula C18H15N2O5SY- and a molecular weight of 460.30 g/mol. Its IUPAC name is [4-[(8-hydroxy-7-methyl-3-sulfonaphthalen-1-yl)carbamoyl]phenyl]azanide;yttrium.
| Compound Name | [4-[(8-hydroxy-7-methyl-3-sulfonaphthalen-1-yl)carbamoyl]phenyl]azanide;yttrium |
|---|---|
| PubChem CID | 59885751 |
| Molecular Formula | C18H15N2O5SY- |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | [4-[(8-hydroxy-7-methyl-3-sulfonaphthalen-1-yl)carbamoyl]phenyl]azanide;yttrium |
| SMILES | Cc1ccc2cc(S(=O)(=O)O)cc(NC(=O)c3ccc([NH-])cc3)c2c1O.[Y] |
| InChI | InChI=1S/C18H16N2O5S.Y/c1-10-2-3-12-8-14(26(23,24)25)9-15(16(12)17(10)21)20-18(22)11-4-6-13(19)7-5-11;/h2-9H,1H3,(H5,19,20,21,22,23,24,25);/p-1 |
| InChIKey | LDDATIAWULUAFL-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|