C22H20FN5O2S — CID 59888977
3-acetyl-7-(4-azido-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-cyclopropyl-6-fluoro-5-methyl-1,8-naphthyridin-4-one (PubChem CID 59888977) has the molecular formula C22H20FN5O2S and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-acetyl-7-(4-azido-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-cyclopropyl-6-fluoro-5-methyl-1,8-naphthyridin-4-one.
| Compound Name | 3-acetyl-7-(4-azido-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-cyclopropyl-6-fluoro-5-methyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 59888977 |
| Molecular Formula | C22H20FN5O2S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-acetyl-7-(4-azido-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-cyclopropyl-6-fluoro-5-methyl-1,8-naphthyridin-4-one |
| SMILES | CC(=O)c1cn(C2CC2)c2nc(-c3cc4c(s3)CCCC4N=[N+]=[N-])c(F)c(C)c2c1=O |
| InChI | InChI=1S/C22H20FN5O2S/c1-10-18-21(30)14(11(2)29)9-28(12-6-7-12)22(18)25-20(19(10)23)17-8-13-15(26-27-24)4-3-5-16(13)31-17/h8-9,12,15H,3-7H2,1-2H3 |
| InChIKey | XJNHARXDWLZLBE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 100.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|