C25H18F3N5O3S — CID 59889147
ethyl 7-(4-azido-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 59889147) has the molecular formula C25H18F3N5O3S and a molecular weight of 525.51 g/mol. Its IUPAC name is ethyl 7-(4-azido-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-(4-azido-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 59889147 |
| Molecular Formula | C25H18F3N5O3S |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | ethyl 7-(4-azido-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(F)cc2F)c2nc(-c3cc4c(s3)CCCC4N=[N+]=[N-])c(F)cc2c1=O |
| InChI | InChI=1S/C25H18F3N5O3S/c1-2-36-25(35)15-11-33(19-7-6-12(26)8-16(19)27)24-14(23(15)34)9-17(28)22(30-24)21-10-13-18(31-32-29)4-3-5-20(13)37-21/h6-11,18H,2-5H2,1H3 |
| InChIKey | PGOGLYAUOZPRSX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 109.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|