C21H40N4O15P2 — CID 59889545
[3-acetamido-4-[2-[2-[(2-acetamido-3-acetyloxybutoxy)-hydroxyphosphoryl]oxyethylcarbamoylamino]ethoxy-hydroxyphosphoryl]oxybutan-2-yl] acetate (PubChem CID 59889545) has the molecular formula C21H40N4O15P2 and a molecular weight of 650.51 g/mol. Its IUPAC name is [3-acetamido-4-[2-[2-[(2-acetamido-3-acetyloxybutoxy)-hydroxyphosphoryl]oxyethylcarbamoylamino]ethoxy-hydroxyphosphoryl]oxybutan-2-yl] acetate.
| Compound Name | [3-acetamido-4-[2-[2-[(2-acetamido-3-acetyloxybutoxy)-hydroxyphosphoryl]oxyethylcarbamoylamino]ethoxy-hydroxyphosphoryl]oxybutan-2-yl] acetate |
|---|---|
| PubChem CID | 59889545 |
| Molecular Formula | C21H40N4O15P2 |
| Molecular Weight | 650.51 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | [3-acetamido-4-[2-[2-[(2-acetamido-3-acetyloxybutoxy)-hydroxyphosphoryl]oxyethylcarbamoylamino]ethoxy-hydroxyphosphoryl]oxybutan-2-yl] acetate |
| SMILES | CC(=O)NC(COP(=O)(O)OCCNC(=O)NCCOP(=O)(O)OCC(NC(C)=O)C(C)OC(C)=O)C(C)OC(C)=O |
| InChI | InChI=1S/C21H40N4O15P2/c1-13(39-17(5)28)19(24-15(3)26)11-37-41(31,32)35-9-7-22-21(30)23-8-10-36-42(33,34)38-12-20(25-16(4)27)14(2)40-18(6)29/h13-14,19-20H,7-12H2,1-6H3,(H,24,26)(H,25,27)(H,31,32)(H,33,34)(H2,22,23,30) |
| InChIKey | NQDZFZGGIMBVSP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 263.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.51 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|