C24H35N2O3S+ — CID 59890358
(4R,5R)-7-amino-3,3-dibutyl-5-(1-methylpyridin-1-ium-4-yl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 59890358) has the molecular formula C24H35N2O3S+ and a molecular weight of 431.62 g/mol. Its IUPAC name is (4R,5R)-7-amino-3,3-dibutyl-5-(1-methylpyridin-1-ium-4-yl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (4R,5R)-7-amino-3,3-dibutyl-5-(1-methylpyridin-1-ium-4-yl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 59890358 |
| Molecular Formula | C24H35N2O3S+ |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | (4R,5R)-7-amino-3,3-dibutyl-5-(1-methylpyridin-1-ium-4-yl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(N)cc2[C@@H](c2cc[n+](C)cc2)[C@H]1O |
| InChI | InChI=1S/C24H35N2O3S/c1-4-6-12-24(13-7-5-2)17-30(28,29)21-9-8-19(25)16-20(21)22(23(24)27)18-10-14-26(3)15-11-18/h8-11,14-16,22-23,27H,4-7,12-13,17,25H2,1-3H3/q+1/t22-,23-/m1/s1 |
| InChIKey | CCPUFWPVCHYNRA-DHIUTWEWSA-N |
| XLogP | 3.74 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|