C19H31Y- — CID 59890611
1-(2,3-dimethylbutan-2-yl)-4-(2,3,3-trimethylbutan-2-yl)benzene;yttrium (PubChem CID 59890611) has the molecular formula C19H31Y- and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-(2,3-dimethylbutan-2-yl)-4-(2,3,3-trimethylbutan-2-yl)benzene;yttrium.
| Compound Name | 1-(2,3-dimethylbutan-2-yl)-4-(2,3,3-trimethylbutan-2-yl)benzene;yttrium |
|---|---|
| PubChem CID | 59890611 |
| Molecular Formula | C19H31Y- |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-(2,3-dimethylbutan-2-yl)-4-(2,3,3-trimethylbutan-2-yl)benzene;yttrium |
| SMILES | C[C-](C)C(C)(C)c1ccc(C(C)(C)C(C)(C)C)cc1.[Y] |
| InChI | InChI=1S/C19H31.Y/c1-14(2)18(6,7)15-10-12-16(13-11-15)19(8,9)17(3,4)5;/h10-13H,1-9H3;/q-1; |
| InChIKey | SUOWFZWPUDHENO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|